About (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate
(4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 46695668) has the molecular formula C17H15BrFNO4S
and a molecular weight of 428.28 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
Molecular Properties
| Compound Name | (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| PubChem CID | 46695668 |
| Molecular Formula | C17H15BrFNO4S |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | O=C(OCc1ccc(Br)cc1F)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H15BrFNO4S/c18-14-6-5-13(16(19)10-14)11-24-17(21)12-3-1-4-15(9-12)20-7-2-8-25(20,22)23/h1,3-6,9-10H,2,7-8,11H2 |
| InChIKey | UFNGZGOSABCIMZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The IUPAC name of (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (CID 46695668) is (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
What is the SMILES notation for (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The canonical SMILES for (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate is O=C(OCc1ccc(Br)cc1F)c1cccc(N2CCCS2(=O)=O)c1.
What is the InChIKey of (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The InChIKey is UFNGZGOSABCIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrFNO4S/c18-14-6-5-13(16(19)10-14)11-24-17(21)12-3-1-4-15(9-12)20-7-2-8-25(20,22)23/h1,3-6,9-10H,2,7-8,11H2.
What are the key properties of (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
(4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate has a molecular weight of 428.28 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-fluorophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate is sourced from PubChem (CID 46695668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).