C19H21N3O5S — CID 2685845
3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-(dimethylsulfamoyl)benzoate (PubChem CID 2685845) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-(dimethylsulfamoyl)benzoate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2685845 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)OCCCn2c(=O)[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C19H21N3O5S/c1-21(2)28(25,26)15-8-5-7-14(13-15)18(23)27-12-6-11-22-17-10-4-3-9-16(17)20-19(22)24/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,20,24) |
| InChIKey | GRSVANQGTBFPHS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|