C17H16ClN3O3 — CID 16578169
3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-amino-4-chlorobenzoate (PubChem CID 16578169) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-amino-4-chlorobenzoate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 16578169 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCCCn2c(=O)[nH]c3ccccc32)ccc1Cl |
| InChI | InChI=1S/C17H16ClN3O3/c18-12-7-6-11(10-13(12)19)16(22)24-9-3-8-21-15-5-2-1-4-14(15)20-17(21)23/h1-2,4-7,10H,3,8-9,19H2,(H,20,23) |
| InChIKey | NOBBJAYAAJKIJI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|