C19H20N2O3 — CID 16523706
3-(2-oxo-3H-benzimidazol-1-yl)propyl 3,5-dimethylbenzoate (PubChem CID 16523706) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3,5-dimethylbenzoate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 16523706 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCCCn2c(=O)[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-10-14(2)12-15(11-13)18(22)24-9-5-8-21-17-7-4-3-6-16(17)20-19(21)23/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,20,23) |
| InChIKey | CCMGQPNQTCKOJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|