C20H19FN2O4 — CID 56528167
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-fluorophenyl)propanoate (PubChem CID 56528167) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-fluorophenyl)propanoate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 56528167 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-fluorophenyl)propanoate |
| SMILES | O=C(CCc1ccccc1F)OCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H19FN2O4/c21-16-8-3-1-6-14(16)10-11-18(24)27-13-5-12-23-19(25)15-7-2-4-9-17(15)22-20(23)26/h1-4,6-9H,5,10-13H2,(H,22,26) |
| InChIKey | GVDWIYHQNGTDAE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|