C20H17N5O5 — CID 56528209
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate (PubChem CID 56528209) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate |
|---|---|
| PubChem CID | 56528209 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 2-(4-oxo-1,2,3-benzotriazin-3-yl)acetate |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)OCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H17N5O5/c26-17(12-25-19(28)14-7-2-4-9-16(14)22-23-25)30-11-5-10-24-18(27)13-6-1-3-8-15(13)21-20(24)29/h1-4,6-9H,5,10-12H2,(H,21,29) |
| InChIKey | CWFYEPNZHZPLHO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|