C20H17ClN2O4 — CID 56528156
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 56528156) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 56528156 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)OCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H17ClN2O4/c21-15-9-6-14(7-10-15)8-11-18(24)27-13-3-12-23-19(25)16-4-1-2-5-17(16)22-20(23)26/h1-2,4-11H,3,12-13H2,(H,22,26)/b11-8+ |
| InChIKey | XRCJRJSDTQAXST-DHZHZOJOSA-N |
| XLogP | 2.99 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|