C24H27ClN4O2 — CID 10138070
3-[4-[3-(4-chlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]butyl]-1H-quinazoline-2,4-dione (PubChem CID 10138070) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 3-[4-[3-(4-chlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]butyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[4-[3-(4-chlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]butyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10138070 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-[4-[3-(4-chlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]butyl]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CCCCN1C2CCC1CN(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C24H27ClN4O2/c25-17-7-9-18(10-8-17)27-15-19-11-12-20(16-27)28(19)13-3-4-14-29-23(30)21-5-1-2-6-22(21)26-24(29)31/h1-2,5-10,19-20H,3-4,11-16H2,(H,26,31) |
| InChIKey | ZNUOQGUHWIWAHG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|