About 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate (PubChem CID 56528222) has the molecular formula C20H19ClN2O4
and a molecular weight of 386.84 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate.
Molecular Properties
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate |
| PubChem CID | 56528222 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate |
| SMILES | O=C(CCc1ccccc1Cl)OCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C20H19ClN2O4/c21-16-8-3-1-6-14(16)10-11-18(24)27-13-5-12-23-19(25)15-7-2-4-9-17(15)22-20(23)26/h1-4,6-9H,5,10-13H2,(H,22,26) |
| InChIKey | DJTVPBKHDXMZTE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate?
The IUPAC name of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate (CID 56528222) is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate.
What is the SMILES notation for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate?
The canonical SMILES for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate is O=C(CCc1ccccc1Cl)OCCCn1c(=O)[nH]c2ccccc2c1=O.
What is the InChIKey of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate?
The InChIKey is DJTVPBKHDXMZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O4/c21-16-8-3-1-6-14(16)10-11-18(24)27-13-5-12-23-19(25)15-7-2-4-9-17(15)22-20(23)26/h1-4,6-9H,5,10-13H2,(H,22,26).
What are the key properties of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate?
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate has a molecular weight of 386.84 g/mol, XLogP of 2.91, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(2-chlorophenyl)propanoate is sourced from PubChem (CID 56528222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).