C14H18N2O3 — CID 47475418
3-(2-ethyl-2-hydroxybutyl)-1H-quinazoline-2,4-dione (PubChem CID 47475418) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(2-ethyl-2-hydroxybutyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2-ethyl-2-hydroxybutyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 47475418 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(2-ethyl-2-hydroxybutyl)-1H-quinazoline-2,4-dione |
| SMILES | CCC(O)(CC)Cn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C14H18N2O3/c1-3-14(19,4-2)9-16-12(17)10-7-5-6-8-11(10)15-13(16)18/h5-8,19H,3-4,9H2,1-2H3,(H,15,18) |
| InChIKey | XXXFHIUHZDFTEQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |