C13H18FN5S — CID 144878561
5-[4-[2-fluoro-6-(methylamino)-3-pyridinyl]butyl]-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 144878561) has the molecular formula C13H18FN5S and a molecular weight of 295.39 g/mol. Its IUPAC name is 5-[4-[2-fluoro-6-(methylamino)-3-pyridinyl]butyl]-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-[2-fluoro-6-(methylamino)-3-pyridinyl]butyl]-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 144878561 |
| Molecular Formula | C13H18FN5S |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-[4-[2-fluoro-6-(methylamino)-3-pyridinyl]butyl]-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1ccc(CCCCc2nnc(NC)s2)c(F)n1 |
| InChI | InChI=1S/C13H18FN5S/c1-15-10-8-7-9(12(14)17-10)5-3-4-6-11-18-19-13(16-2)20-11/h7-8H,3-6H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | QNSXZKHTBSVLQD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|