C16H18F2N4O2S2 — CID 145168351
2-(2,4-difluoro-3-hydroxyphenyl)-N-[5-[5-(methylamino)-5-sulfanylidenepentyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 145168351) has the molecular formula C16H18F2N4O2S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-hydroxyphenyl)-N-[5-[5-(methylamino)-5-sulfanylidenepentyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-difluoro-3-hydroxyphenyl)-N-[5-[5-(methylamino)-5-sulfanylidenepentyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 145168351 |
| Molecular Formula | C16H18F2N4O2S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-(2,4-difluoro-3-hydroxyphenyl)-N-[5-[5-(methylamino)-5-sulfanylidenepentyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNC(=S)CCCCc1nnc(NC(=O)Cc2ccc(F)c(O)c2F)s1 |
| InChI | InChI=1S/C16H18F2N4O2S2/c1-19-12(25)4-2-3-5-13-21-22-16(26-13)20-11(23)8-9-6-7-10(17)15(24)14(9)18/h6-7,24H,2-5,8H2,1H3,(H,19,25)(H,20,22,23) |
| InChIKey | JLGPRBJXYXHEOR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|