C7H8ClN3O3S — CID 156888790
ethyl 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate (PubChem CID 156888790) has the molecular formula C7H8ClN3O3S and a molecular weight of 249.68 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 156888790 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 249.68 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | ethyl 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1nnc(Cl)s1 |
| InChI | InChI=1S/C7H8ClN3O3S/c1-2-14-5(13)3-4(12)9-7-11-10-6(8)15-7/h2-3H2,1H3,(H,9,11,12) |
| InChIKey | VNNAPCATUWQVHA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|