About fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate
fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate (PubChem CID 156888714) has the molecular formula C5H3ClFN3O3S
and a molecular weight of 239.62 g/mol. Its IUPAC name is fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate.
Molecular Properties
| Compound Name | fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate |
| PubChem CID | 156888714 |
| Molecular Formula | C5H3ClFN3O3S |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate |
| SMILES | O=C(CC(=O)OF)Nc1nnc(Cl)s1 |
| InChI | InChI=1S/C5H3ClFN3O3S/c6-4-9-10-5(14-4)8-2(11)1-3(12)13-7/h1H2,(H,8,10,11) |
| InChIKey | ZVELXGRSVGLTMU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate?
The IUPAC name of fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate (CID 156888714) is fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate.
What is the SMILES notation for fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate?
The canonical SMILES for fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate is O=C(CC(=O)OF)Nc1nnc(Cl)s1.
What is the InChIKey of fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate?
The InChIKey is ZVELXGRSVGLTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClFN3O3S/c6-4-9-10-5(14-4)8-2(11)1-3(12)13-7/h1H2,(H,8,10,11).
What are the key properties of fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate?
fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate has a molecular weight of 239.62 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-[(5-chloro-1,3,4-thiadiazol-2-yl)amino]-3-oxopropanoate is sourced from PubChem (CID 156888714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).