C12H8Cl5N3O2S — CID 19178155
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19178155) has the molecular formula C12H8Cl5N3O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19178155 |
| Molecular Formula | C12H8Cl5N3O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | CCc1nnc(NC(=O)COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C12H8Cl5N3O2S/c1-2-5-19-20-12(23-5)18-4(21)3-22-11-9(16)7(14)6(13)8(15)10(11)17/h2-3H2,1H3,(H,18,20,21) |
| InChIKey | LUKIFPAXHJKDDF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|