C15H13N3O4S — CID 26881258
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 26881258) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 26881258 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCc1nnc(NC(=O)COc2ccc3ccc(=O)oc3c2)s1 |
| InChI | InChI=1S/C15H13N3O4S/c1-2-13-17-18-15(23-13)16-12(19)8-21-10-5-3-9-4-6-14(20)22-11(9)7-10/h3-7H,2,8H2,1H3,(H,16,18,19) |
| InChIKey | HUWXDMFCSUIAFC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|