C22H15Cl2N3OS2 — CID 17104536
N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 17104536) has the molecular formula C22H15Cl2N3OS2 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17104536 |
| Molecular Formula | C22H15Cl2N3OS2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1nc2c(Cl)c(Cl)ccc2s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2N3OS2/c23-15-11-12-16-19(18(15)24)25-22(30-16)27-21(29)26-20(28)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,17H,(H2,25,26,27,28,29) |
| InChIKey | JCIIALFOYPZRFH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|