C21H14N4O4S — CID 108728996
N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 108728996) has the molecular formula C21H14N4O4S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 108728996 |
| Molecular Formula | C21H14N4O4S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(-c2csc3nc(NC(=O)c4cc5ccccc5oc4=O)nn23)cc1 |
| InChI | InChI=1S/C21H14N4O4S/c1-28-14-8-6-12(7-9-14)16-11-30-21-23-20(24-25(16)21)22-18(26)15-10-13-4-2-3-5-17(13)29-19(15)27/h2-11H,1H3,(H,22,24,26) |
| InChIKey | LYPNCPOFOJHKAR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|