C17H17BrN2O4S — CID 55333982
(E)-3-(5-bromothiophen-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 55333982) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 55333982 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C17H17BrN2O4S/c1-2-23-13-5-3-4-6-14(13)24-11-17(22)20-19-16(21)10-8-12-7-9-15(18)25-12/h3-10H,2,11H2,1H3,(H,19,21)(H,20,22)/b10-8+ |
| InChIKey | NCFCKWIMHBXLPF-CSKARUKUSA-N |
| XLogP | 3.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|