C19H19FN2O4 — CID 9471914
(E)-3-(2-ethoxyphenyl)-N'-[2-(2-fluorophenoxy)acetyl]prop-2-enehydrazide (PubChem CID 9471914) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is (E)-3-(2-ethoxyphenyl)-N'-[2-(2-fluorophenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(2-ethoxyphenyl)-N'-[2-(2-fluorophenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9471914 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (E)-3-(2-ethoxyphenyl)-N'-[2-(2-fluorophenoxy)acetyl]prop-2-enehydrazide |
| SMILES | CCOc1ccccc1/C=C/C(=O)NNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C19H19FN2O4/c1-2-25-16-9-5-3-7-14(16)11-12-18(23)21-22-19(24)13-26-17-10-6-4-8-15(17)20/h3-12H,2,13H2,1H3,(H,21,23)(H,22,24)/b12-11+ |
| InChIKey | IJGKKDCBFNGRKN-VAWYXSNFSA-N |
| XLogP | 2.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|