C17H20BrNO3S — CID 26851346
5-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 26851346) has the molecular formula C17H20BrNO3S and a molecular weight of 398.32 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26851346 |
| Molecular Formula | C17H20BrNO3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 5-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(Br)s2)cc1OCC |
| InChI | InChI=1S/C17H20BrNO3S/c1-3-21-13-6-5-12(11-14(13)22-4-2)9-10-19-17(20)15-7-8-16(18)23-15/h5-8,11H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | QERUHYUAGQJQCQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |