C13H13BrN2O3S — CID 41088369
5-bromo-N-[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl]furan-2-carboxamide (PubChem CID 41088369) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 5-bromo-N-[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41088369 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 5-bromo-N-[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)CNC(=O)c1ccc(Br)o1)c1cccs1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-8(10-3-2-6-20-10)16-12(17)7-15-13(18)9-4-5-11(14)19-9/h2-6,8H,7H2,1H3,(H,15,18)(H,16,17)/t8-/m0/s1 |
| InChIKey | HJSMOPGBDVAFAU-QMMMGPOBSA-N |
| XLogP | 2.71 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |