C13H14BrNO2S — CID 61380869
5-bromo-N-(1-thiophen-2-ylbutyl)furan-2-carboxamide (PubChem CID 61380869) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is 5-bromo-N-(1-thiophen-2-ylbutyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(1-thiophen-2-ylbutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 61380869 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 5-bromo-N-(1-thiophen-2-ylbutyl)furan-2-carboxamide |
| SMILES | CCCC(NC(=O)c1ccc(Br)o1)c1cccs1 |
| InChI | InChI=1S/C13H14BrNO2S/c1-2-4-9(11-5-3-8-18-11)15-13(16)10-6-7-12(14)17-10/h3,5-9H,2,4H2,1H3,(H,15,16) |
| InChIKey | XLWOSHNYCGAUCB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |