C13H9BrClNO5S — CID 7884019
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 7884019) has the molecular formula C13H9BrClNO5S and a molecular weight of 406.64 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 7884019 |
| Molecular Formula | C13H9BrClNO5S |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H9BrClNO5S/c14-10-3-1-8(21-10)13(19)16-5-12(18)20-6-7(17)9-2-4-11(15)22-9/h1-4H,5-6H2,(H,16,19) |
| InChIKey | GNSPEGUEBRZOFG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |