C15H18N2O5 — CID 9019738
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-formylbenzoate (PubChem CID 9019738) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-formylbenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 9019738 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-formylbenzoate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C15H18N2O5/c1-2-7-16-13(19)8-17-14(20)10-22-15(21)12-5-3-11(9-18)4-6-12/h3-6,9H,2,7-8,10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | FPTXTUBHJFMXKF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|