C21H23NO7 — CID 159419255
2-(4-formylphenoxy)acetic acid;2-(4-formylphenoxy)-N-propylacetamide (PubChem CID 159419255) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(4-formylphenoxy)acetic acid;2-(4-formylphenoxy)-N-propylacetamide.
| Compound Name | 2-(4-formylphenoxy)acetic acid;2-(4-formylphenoxy)-N-propylacetamide |
|---|---|
| PubChem CID | 159419255 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-(4-formylphenoxy)acetic acid;2-(4-formylphenoxy)-N-propylacetamide |
| SMILES | CCCNC(=O)COc1ccc(C=O)cc1.O=Cc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO3.C9H8O4/c1-2-7-13-12(15)9-16-11-5-3-10(8-14)4-6-11;10-5-7-1-3-8(4-2-7)13-6-9(11)12/h3-6,8H,2,7,9H2,1H3,(H,13,15);1-5H,6H2,(H,11,12) |
| InChIKey | LPOARABWWVNROO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|