C17H22N2O6 — CID 8808985
[2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-(4-formylphenoxy)acetate (PubChem CID 8808985) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-(4-formylphenoxy)acetate.
| Compound Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8808985 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-(4-formylphenoxy)acetate |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)COC(=O)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H22N2O6/c1-3-8-18-17(23)12(2)19-15(21)10-25-16(22)11-24-14-6-4-13(9-20)5-7-14/h4-7,9,12H,3,8,10-11H2,1-2H3,(H,18,23)(H,19,21)/t12-/m1/s1 |
| InChIKey | RTLYWXRTZAJMQD-GFCCVEGCSA-N |
| XLogP | 0.45 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|