C16H20N2O6 — CID 8808989
[2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 2-(4-formylphenoxy)acetate (PubChem CID 8808989) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 2-(4-formylphenoxy)acetate.
| Compound Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8808989 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 2-(4-formylphenoxy)acetate |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)COC(=O)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C16H20N2O6/c1-3-17-16(22)11(2)18-14(20)9-24-15(21)10-23-13-6-4-12(8-19)5-7-13/h4-8,11H,3,9-10H2,1-2H3,(H,17,22)(H,18,20)/t11-/m1/s1 |
| InChIKey | FSLWSTRAWMPXAH-LLVKDONJSA-N |
| XLogP | 0.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|