C14H18N2O4 — CID 9018937
[2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] benzoate (PubChem CID 9018937) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] benzoate.
| Compound Name | [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 9018937 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] benzoate |
| SMILES | CCNC(=O)[C@H](C)NC(=O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-15-13(18)10(2)16-12(17)9-20-14(19)11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3,(H,15,18)(H,16,17)/t10-/m0/s1 |
| InChIKey | YLBAPGCKJFJOTL-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |