C14H16ClFN2O4 — CID 8664509
[2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 4-chloro-2-fluorobenzoate (PubChem CID 8664509) has the molecular formula C14H16ClFN2O4 and a molecular weight of 330.74 g/mol. Its IUPAC name is [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 4-chloro-2-fluorobenzoate.
| Compound Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 4-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8664509 |
| Molecular Formula | C14H16ClFN2O4 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 4-chloro-2-fluorobenzoate |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)COC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H16ClFN2O4/c1-3-17-13(20)8(2)18-12(19)7-22-14(21)10-5-4-9(15)6-11(10)16/h4-6,8H,3,7H2,1-2H3,(H,17,20)(H,18,19)/t8-/m1/s1 |
| InChIKey | DBYSRBIWSGMBBF-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |