C15H19ClN2O5 — CID 8847713
[2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate (PubChem CID 8847713) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 8847713 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-[[(2S)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] 5-chloro-2-methoxybenzoate |
| SMILES | CCNC(=O)[C@H](C)NC(=O)COC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H19ClN2O5/c1-4-17-14(20)9(2)18-13(19)8-23-15(21)11-7-10(16)5-6-12(11)22-3/h5-7,9H,4,8H2,1-3H3,(H,17,20)(H,18,19)/t9-/m0/s1 |
| InChIKey | OVXBSGXOFALHCM-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |