C16H22N2O5 — CID 9008540
[2-[[(2S)-5-methylhexan-2-yl]amino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 9008540) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-[[(2S)-5-methylhexan-2-yl]amino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[[(2S)-5-methylhexan-2-yl]amino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 9008540 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-[[(2S)-5-methylhexan-2-yl]amino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | CC(C)CC[C@H](C)NC(=O)COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-11(2)4-5-12(3)17-15(19)10-23-16(20)13-6-8-14(9-7-13)18(21)22/h6-9,11-12H,4-5,10H2,1-3H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | NGMRWHQNDDUSTB-LBPRGKRZSA-N |
| XLogP | 2.69 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|