C17H20ClN3O6 — CID 8604082
[2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 8604082) has the molecular formula C17H20ClN3O6 and a molecular weight of 397.82 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 8604082 |
| Molecular Formula | C17H20ClN3O6 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)NC(=O)COC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20ClN3O6/c1-10-4-2-3-5-13(10)19-17(24)20-15(22)9-27-16(23)12-8-11(18)6-7-14(12)21(25)26/h6-8,10,13H,2-5,9H2,1H3,(H2,19,20,22,24)/t10-,13-/m1/s1 |
| InChIKey | FILMWRVQHFWKIA-ZWNOBZJWSA-N |
| XLogP | 2.81 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|