C19H23N3O8 — CID 55367922
[2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 55367922) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 55367922 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | CC1CCCCC1NC(=O)NC(=O)COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C19H23N3O8/c1-11-4-2-3-5-13(11)20-19(25)21-17(23)10-30-18(24)12-8-15-16(29-7-6-28-15)9-14(12)22(26)27/h8-9,11,13H,2-7,10H2,1H3,(H2,20,21,23,25) |
| InChIKey | ITBPNCIDYYAFRY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|