C17H16ClN3O5 — CID 2554112
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 2554112) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2554112 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16ClN3O5/c1-20(2)13-6-4-12(5-7-13)19-16(22)10-26-17(23)14-9-11(18)3-8-15(14)21(24)25/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | PCRKDIOTOTXGGO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|