C14H19NO6 — CID 18102825
[2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] furan-3-carboxylate (PubChem CID 18102825) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 18102825 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [2-[(1-methoxy-3-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] furan-3-carboxylate |
| SMILES | CCC(C)C(NC(=O)COC(=O)c1ccoc1)C(=O)OC |
| InChI | InChI=1S/C14H19NO6/c1-4-9(2)12(14(18)19-3)15-11(16)8-21-13(17)10-5-6-20-7-10/h5-7,9,12H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | BDSGAGGDYVTMKO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |