C17H20ClN3O3 — CID 87983811
5-chloro-N-[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-2-methoxybenzamide (PubChem CID 87983811) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 87983811 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-chloro-N-[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N[C@@H]1CCCC[C@H]1C(=O)NCC#N |
| InChI | InChI=1S/C17H20ClN3O3/c1-24-15-7-6-11(18)10-13(15)17(23)21-14-5-3-2-4-12(14)16(22)20-9-8-19/h6-7,10,12,14H,2-5,9H2,1H3,(H,20,22)(H,21,23)/t12-,14-/m1/s1 |
| InChIKey | BYAHDLQWNHORBO-TZMCWYRMSA-N |
| XLogP | 2.28 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|