C17H20ClN3O2S — CID 18417005
2-chloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-5-methylsulfanylbenzamide (PubChem CID 18417005) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 18417005 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-chloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NC2CCCCC2C(=O)NCC#N)c1 |
| InChI | InChI=1S/C17H20ClN3O2S/c1-24-11-6-7-14(18)13(10-11)17(23)21-15-5-3-2-4-12(15)16(22)20-9-8-19/h6-7,10,12,15H,2-5,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | LZEZZWLDUUGRNO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|