C17H22N2O3S2 — CID 87700590
(1R)-N-(cyanomethyl)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexane-1-carboxamide (PubChem CID 87700590) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (1R)-N-(cyanomethyl)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexane-1-carboxamide.
| Compound Name | (1R)-N-(cyanomethyl)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87700590 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (1R)-N-(cyanomethyl)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexane-1-carboxamide |
| SMILES | CSc1ccc(S(=O)(=O)CC2CCCC[C@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-23-14-6-8-15(9-7-14)24(21,22)12-13-4-2-3-5-16(13)17(20)19-11-10-18/h6-9,13,16H,2-5,11-12H2,1H3,(H,19,20)/t13?,16-/m1/s1 |
| InChIKey | CFBDLITUAFRXGT-FQNRMIAFSA-N |
| XLogP | 2.63 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|