C21H30N4O3S — CID 87700231
cis-(1R,2R)-N-(cyanomethyl)-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide (PubChem CID 87700231) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is cis-(1R,2R)-N-(cyanomethyl)-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(cyanomethyl)-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87700231 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | cis-(1R,2R)-N-(cyanomethyl)-2-[[4-(4-methylpiperazin-1-yl)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide |
| SMILES | CN1CCN(c2ccc(S(=O)(=O)C[C@@H]3CCCC[C@H]3C(=O)NCC#N)cc2)CC1 |
| InChI | InChI=1S/C21H30N4O3S/c1-24-12-14-25(15-13-24)18-6-8-19(9-7-18)29(27,28)16-17-4-2-3-5-20(17)21(26)23-11-10-22/h6-9,17,20H,2-5,11-16H2,1H3,(H,23,26)/t17-,20+/m0/s1 |
| InChIKey | UFFRFIPFZJYODF-FXAWDEMLSA-N |
| XLogP | 1.66 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|