C16H18Cl2N2O3S — CID 87700011
cis-(1R,2R)-N-(cyanomethyl)-2-[(3,4-dichlorophenyl)sulfonylmethyl]cyclohexane-1-carboxamide (PubChem CID 87700011) has the molecular formula C16H18Cl2N2O3S and a molecular weight of 389.30 g/mol. Its IUPAC name is cis-(1R,2R)-N-(cyanomethyl)-2-[(3,4-dichlorophenyl)sulfonylmethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(cyanomethyl)-2-[(3,4-dichlorophenyl)sulfonylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87700011 |
| Molecular Formula | C16H18Cl2N2O3S |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | cis-(1R,2R)-N-(cyanomethyl)-2-[(3,4-dichlorophenyl)sulfonylmethyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@H]1CS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2O3S/c17-14-6-5-12(9-15(14)18)24(22,23)10-11-3-1-2-4-13(11)16(21)20-8-7-19/h5-6,9,11,13H,1-4,8,10H2,(H,20,21)/t11-,13+/m0/s1 |
| InChIKey | XHVVUUGCJSTUOQ-WCQYABFASA-N |
| XLogP | 3.21 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|