C18H20N4O2 — CID 20740205
N-[(1S,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-1H-indole-5-carboxamide (PubChem CID 20740205) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(1S,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-1H-indole-5-carboxamide.
| Compound Name | N-[(1S,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 20740205 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[(1S,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]-1H-indole-5-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H20N4O2/c19-8-10-21-18(24)14-3-1-2-4-16(14)22-17(23)13-5-6-15-12(11-13)7-9-20-15/h5-7,9,11,14,16,20H,1-4,10H2,(H,21,24)(H,22,23)/t14-,16+/m1/s1 |
| InChIKey | AXLMHCZGWYCIHR-ZBFHGGJFSA-N |
| XLogP | 2.10 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|