C17H19Cl2N3O3 — CID 18417047
2,6-dichloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-4-methoxybenzamide (PubChem CID 18417047) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-4-methoxybenzamide.
| Compound Name | 2,6-dichloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18417047 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2,6-dichloro-N-[2-(cyanomethylcarbamoyl)cyclohexyl]-4-methoxybenzamide |
| SMILES | COc1cc(Cl)c(C(=O)NC2CCCCC2C(=O)NCC#N)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-25-10-8-12(18)15(13(19)9-10)17(24)22-14-5-3-2-4-11(14)16(23)21-7-6-20/h8-9,11,14H,2-5,7H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | BIQADLKOUXEQAU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|