C17H20Cl2N2OS — CID 85078671
N-(cyanomethyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethyl]cyclohexane-1-carboxamide (PubChem CID 85078671) has the molecular formula C17H20Cl2N2OS and a molecular weight of 371.33 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethyl]cyclohexane-1-carboxamide.
| Compound Name | N-(cyanomethyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 85078671 |
| Molecular Formula | C17H20Cl2N2OS |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-(cyanomethyl)-2-[(2,4-dichlorophenyl)methylsulfanylmethyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)C1CCCCC1CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2OS/c18-14-6-5-13(16(19)9-14)11-23-10-12-3-1-2-4-15(12)17(22)21-8-7-20/h5-6,9,12,15H,1-4,8,10-11H2,(H,21,22) |
| InChIKey | ZEPWHTUXYUZIHR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|