C15H19ClF3NO — CID 60957296
N-[(5-chloro-2-methoxyphenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 60957296) has the molecular formula C15H19ClF3NO and a molecular weight of 321.77 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 60957296 |
| Molecular Formula | C15H19ClF3NO |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | COc1ccc(Cl)cc1CNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H19ClF3NO/c1-21-14-7-6-11(16)8-10(14)9-20-13-5-3-2-4-12(13)15(17,18)19/h6-8,12-13,20H,2-5,9H2,1H3 |
| InChIKey | OHCGTZOHQPJAMU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |