C17H14N4OS2 — CID 17451831
2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 17451831) has the molecular formula C17H14N4OS2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 17451831 |
| Molecular Formula | C17H14N4OS2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cn3ccccc3n2)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H14N4OS2/c1-2-7-21-16(22)15-13(6-9-23-15)19-17(21)24-11-12-10-20-8-4-3-5-14(20)18-12/h2-6,8-10H,1,7,11H2 |
| InChIKey | SQMQYISIQNQDTE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|