C23H18N4OS2 — CID 1183938
2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-5-phenyl-1-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 1183938) has the molecular formula C23H18N4OS2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-5-phenyl-1-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-5-phenyl-1-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1183938 |
| Molecular Formula | C23H18N4OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-5-phenyl-1-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cn3ccccc3n2)nc(=O)c2c(-c3ccccc3)csc21 |
| InChI | InChI=1S/C23H18N4OS2/c1-2-11-27-22-20(18(15-29-22)16-8-4-3-5-9-16)21(28)25-23(27)30-14-17-13-26-12-7-6-10-19(26)24-17/h2-10,12-13,15H,1,11,14H2 |
| InChIKey | ZDENLFJAHRNANI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|