C15H18N6OS2 — CID 18123583
2-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 18123583) has the molecular formula C15H18N6OS2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18123583 |
| Molecular Formula | C15H18N6OS2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2nnnn2CCCC)nc2ccsc2c1=O |
| InChI | InChI=1S/C15H18N6OS2/c1-3-5-8-21-12(17-18-19-21)10-24-15-16-11-6-9-23-13(11)14(22)20(15)7-4-2/h4,6,9H,2-3,5,7-8,10H2,1H3 |
| InChIKey | ZEQMLLNKXUTFOE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|