C17H21N3O2S2 — CID 41176732
(2R)-N-cyclopentyl-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 41176732) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-cyclopentyl-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 41176732 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2R)-N-cyclopentyl-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)NC2CCCC2)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H21N3O2S2/c1-3-9-20-16(22)14-13(8-10-23-14)19-17(20)24-11(2)15(21)18-12-6-4-5-7-12/h3,8,10-12H,1,4-7,9H2,2H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | MCPPQUAPHFRBPU-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|