C22H29N3O2S — CID 11941033
(2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide (PubChem CID 11941033) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 11941033 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)N[C@H]2CCC[C@@H](C)[C@H]2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H29N3O2S/c1-5-13-25-21(27)17-10-6-7-11-19(17)24-22(25)28-16(4)20(26)23-18-12-8-9-14(2)15(18)3/h5-7,10-11,14-16,18H,1,8-9,12-13H2,2-4H3,(H,23,26)/t14-,15-,16-,18+/m1/s1 |
| InChIKey | NPKDKZHXVHSZMK-KONPQCLYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|